C13H17N3O4 — CID 102890825
2-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 102890825) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 102890825 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | O=C1CCC(C(=O)N2CC3CCCC3C2C(=O)O)=NN1 |
| InChI | InChI=1S/C13H17N3O4/c17-10-5-4-9(14-15-10)12(18)16-6-7-2-1-3-8(7)11(16)13(19)20/h7-8,11H,1-6H2,(H,15,17)(H,19,20) |
| InChIKey | VDOPJHHYCDQSGF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |