C17H23BrN2O — CID 102890840
N-[2-(4-bromophenyl)propan-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 102890840) has the molecular formula C17H23BrN2O and a molecular weight of 351.29 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)propan-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-[2-(4-bromophenyl)propan-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 102890840 |
| Molecular Formula | C17H23BrN2O |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[2-(4-bromophenyl)propan-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC(C)(NC(=O)C1NCC2CCCC21)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H23BrN2O/c1-17(2,12-6-8-13(18)9-7-12)20-16(21)15-14-5-3-4-11(14)10-19-15/h6-9,11,14-15,19H,3-5,10H2,1-2H3,(H,20,21) |
| InChIKey | KWKWUOXYCPHURN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |