C12H18F2N2O3 — CID 102890860
2-[2,2-difluoroethyl(methyl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 102890860) has the molecular formula C12H18F2N2O3 and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(methyl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-[2,2-difluoroethyl(methyl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 102890860 |
| Molecular Formula | C12H18F2N2O3 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-[2,2-difluoroethyl(methyl)carbamoyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | CN(CC(F)F)C(=O)N1CC2CCCC2C1C(=O)O |
| InChI | InChI=1S/C12H18F2N2O3/c1-15(6-9(13)14)12(19)16-5-7-3-2-4-8(7)10(16)11(17)18/h7-10H,2-6H2,1H3,(H,17,18) |
| InChIKey | BAHZEQDEGRDFQE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |