C24H54N8O3 — CID 10289155
7,19,30-trioxa-1,4,10,13,16,22,27,33-octazabicyclo[11.11.11]pentatriacontane (PubChem CID 10289155) has the molecular formula C24H54N8O3 and a molecular weight of 502.75 g/mol. Its IUPAC name is 7,19,30-trioxa-1,4,10,13,16,22,27,33-octazabicyclo[11.11.11]pentatriacontane.
| Compound Name | 7,19,30-trioxa-1,4,10,13,16,22,27,33-octazabicyclo[11.11.11]pentatriacontane |
|---|---|
| PubChem CID | 10289155 |
| Molecular Formula | C24H54N8O3 |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.43 |
| IUPAC Name | 7,19,30-trioxa-1,4,10,13,16,22,27,33-octazabicyclo[11.11.11]pentatriacontane |
| SMILES | C1COCCNCCN2CCNCCOCCNCCN(CCN1)CCNCCOCCNCC2 |
| InChI | InChI=1S/C24H54N8O3/c1-13-31-14-2-26-9-21-34-23-11-29-5-17-32(16-4-28-8-20-33-19-7-25-1)18-6-30-12-24-35-22-10-27-3-15-31/h25-30H,1-24H2 |
| InChIKey | WYVALDYRYFQCEI-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|