C14H19N3O3 — CID 102891836
methyl 2-amino-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoate (PubChem CID 102891836) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl 2-amino-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoate.
| Compound Name | methyl 2-amino-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoate |
|---|---|
| PubChem CID | 102891836 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | methyl 2-amino-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzoate |
| SMILES | COC(=O)c1cccc(N2CCCN(C)C(=O)C2)c1N |
| InChI | InChI=1S/C14H19N3O3/c1-16-7-4-8-17(9-12(16)18)11-6-3-5-10(13(11)15)14(19)20-2/h3,5-6H,4,7-9,15H2,1-2H3 |
| InChIKey | BBCTVAWJORIPQK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|