C13H22N2O3 — CID 102892105
2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)-3-methylbutanoic acid (PubChem CID 102892105) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)-3-methylbutanoic acid.
| Compound Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 102892105 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C1NCC2CCCC21)C(=O)O |
| InChI | InChI=1S/C13H22N2O3/c1-7(2)10(13(17)18)15-12(16)11-9-5-3-4-8(9)6-14-11/h7-11,14H,3-6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | DRCMIFYHSUQZDU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |