C12H19F3N2O — CID 102892787
N-ethyl-N-(2,2,2-trifluoroethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 102892787) has the molecular formula C12H19F3N2O and a molecular weight of 264.29 g/mol. Its IUPAC name is N-ethyl-N-(2,2,2-trifluoroethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-ethyl-N-(2,2,2-trifluoroethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 102892787 |
| Molecular Formula | C12H19F3N2O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-ethyl-N-(2,2,2-trifluoroethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CCN(CC(F)(F)F)C(=O)C1NCC2CCCC21 |
| InChI | InChI=1S/C12H19F3N2O/c1-2-17(7-12(13,14)15)11(18)10-9-5-3-4-8(9)6-16-10/h8-10,16H,2-7H2,1H3 |
| InChIKey | YARASZFXBWXQJY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |