C11H18F2N2O — CID 102893821
N-(2,2-difluoroethyl)-N-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 102893821) has the molecular formula C11H18F2N2O and a molecular weight of 232.27 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-N-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 102893821 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CN(CC(F)F)C(=O)C1NCC2CCCC21 |
| InChI | InChI=1S/C11H18F2N2O/c1-15(6-9(12)13)11(16)10-8-4-2-3-7(8)5-14-10/h7-10,14H,2-6H2,1H3 |
| InChIKey | QEVKWPQZYPGUHZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |