C19H29NO — CID 102894005
2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-[4-(2-methylpropyl)phenyl]ethanol (PubChem CID 102894005) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-[4-(2-methylpropyl)phenyl]ethanol.
| Compound Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-[4-(2-methylpropyl)phenyl]ethanol |
|---|---|
| PubChem CID | 102894005 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-[4-(2-methylpropyl)phenyl]ethanol |
| SMILES | CC(C)Cc1ccc(C(O)CC2NCC3CCCC32)cc1 |
| InChI | InChI=1S/C19H29NO/c1-13(2)10-14-6-8-15(9-7-14)19(21)11-18-17-5-3-4-16(17)12-20-18/h6-9,13,16-21H,3-5,10-12H2,1-2H3 |
| InChIKey | JFLDELWYIBKQOE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |