C19H27NO — CID 102894018
2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-4-phenylcyclohexan-1-ol (PubChem CID 102894018) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-4-phenylcyclohexan-1-ol.
| Compound Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-4-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 102894018 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-4-phenylcyclohexan-1-ol |
| SMILES | OC1CCC(c2ccccc2)CC1C1NCC2CCCC21 |
| InChI | InChI=1S/C19H27NO/c21-18-10-9-14(13-5-2-1-3-6-13)11-17(18)19-16-8-4-7-15(16)12-20-19/h1-3,5-6,14-21H,4,7-12H2 |
| InChIKey | KUOOUJGYHHPBCD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |