C15H20N2O3 — CID 102894051
2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-(4-nitrophenyl)ethanol (PubChem CID 102894051) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-(4-nitrophenyl)ethanol.
| Compound Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-(4-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 102894051 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-(4-nitrophenyl)ethanol |
| SMILES | O=[N+]([O-])c1ccc(C(O)CC2NCC3CCCC32)cc1 |
| InChI | InChI=1S/C15H20N2O3/c18-15(10-4-6-12(7-5-10)17(19)20)8-14-13-3-1-2-11(13)9-16-14/h4-7,11,13-16,18H,1-3,8-9H2 |
| InChIKey | OHTJZSRNXQMTLQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|