C16H23NO2S — CID 102894110
3-[2-(4-methylsulfonylphenyl)ethyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole (PubChem CID 102894110) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 3-[2-(4-methylsulfonylphenyl)ethyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole.
| Compound Name | 3-[2-(4-methylsulfonylphenyl)ethyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 102894110 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-[2-(4-methylsulfonylphenyl)ethyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
| SMILES | CS(=O)(=O)c1ccc(CCC2NCC3CCCC32)cc1 |
| InChI | InChI=1S/C16H23NO2S/c1-20(18,19)14-8-5-12(6-9-14)7-10-16-15-4-2-3-13(15)11-17-16/h5-6,8-9,13,15-17H,2-4,7,10-11H2,1H3 |
| InChIKey | SMDVZWDTFTVNLQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |