C14H26N2O — CID 102894231
4-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,6-dimethylmorpholine (PubChem CID 102894231) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 4-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,6-dimethylmorpholine.
| Compound Name | 4-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 102894231 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 4-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(CC2NCC3CCCC32)CC(C)O1 |
| InChI | InChI=1S/C14H26N2O/c1-10-7-16(8-11(2)17-10)9-14-13-5-3-4-12(13)6-15-14/h10-15H,3-9H2,1-2H3 |
| InChIKey | FTFGVGFASUYGND-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |