C11H19F3N2 — CID 102894302
N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,2,2-trifluoro-N-methylethanamine (PubChem CID 102894302) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,2,2-trifluoro-N-methylethanamine.
| Compound Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,2,2-trifluoro-N-methylethanamine |
|---|---|
| PubChem CID | 102894302 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,2,2-trifluoro-N-methylethanamine |
| SMILES | CN(CC1NCC2CCCC21)CC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2/c1-16(7-11(12,13)14)6-10-9-4-2-3-8(9)5-15-10/h8-10,15H,2-7H2,1H3 |
| InChIKey | GGCDFJSPVOMBKV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |