C13H24N2O — CID 102894324
N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-1-(oxolan-2-yl)methanamine (PubChem CID 102894324) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-1-(oxolan-2-yl)methanamine.
| Compound Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-1-(oxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 102894324 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-1-(oxolan-2-yl)methanamine |
| SMILES | C1COC(CNCC2NCC3CCCC32)C1 |
| InChI | InChI=1S/C13H24N2O/c1-3-10-7-15-13(12(10)5-1)9-14-8-11-4-2-6-16-11/h10-15H,1-9H2 |
| InChIKey | KTTCCNXZEQWSLD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |