C10H16N4 — CID 102894913
3-(4-methyl-1,2,4-triazol-3-yl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole (PubChem CID 102894913) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 3-(4-methyl-1,2,4-triazol-3-yl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole.
| Compound Name | 3-(4-methyl-1,2,4-triazol-3-yl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 102894913 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 3-(4-methyl-1,2,4-triazol-3-yl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
| SMILES | Cn1cnnc1C1NCC2CCCC21 |
| InChI | InChI=1S/C10H16N4/c1-14-6-12-13-10(14)9-8-4-2-3-7(8)5-11-9/h6-9,11H,2-5H2,1H3 |
| InChIKey | JCFHYECMYYWPBB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |