C12H20N4O — CID 102894918
3-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole (PubChem CID 102894918) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole.
| Compound Name | 3-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 102894918 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole |
| SMILES | COCCn1cnnc1C1NCC2CCCC21 |
| InChI | InChI=1S/C12H20N4O/c1-17-6-5-16-8-14-15-12(16)11-10-4-2-3-9(10)7-13-11/h8-11,13H,2-7H2,1H3 |
| InChIKey | CTXDKEMFPOHVPK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |