C16H22N2O2 — CID 102894976
4,5-dimethoxy-1,8-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6-triene (PubChem CID 102894976) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4,5-dimethoxy-1,8-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6-triene.
| Compound Name | 4,5-dimethoxy-1,8-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6-triene |
|---|---|
| PubChem CID | 102894976 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4,5-dimethoxy-1,8-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6-triene |
| SMILES | COc1cc2c(cc1OC)N1CC3CCCC3C1CN2 |
| InChI | InChI=1S/C16H22N2O2/c1-19-15-6-12-13(7-16(15)20-2)18-9-10-4-3-5-11(10)14(18)8-17-12/h6-7,10-11,14,17H,3-5,8-9H2,1-2H3 |
| InChIKey | KQMWBTAXEFWLSU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|