C13H17N3 — CID 102894993
1,5,8-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-2(7),3,5-triene (PubChem CID 102894993) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 1,5,8-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-2(7),3,5-triene.
| Compound Name | 1,5,8-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 102894993 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1,5,8-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-2(7),3,5-triene |
| SMILES | c1cc2c(cn1)NCC1C3CCCC3CN21 |
| InChI | InChI=1S/C13H17N3/c1-2-9-8-16-12-4-5-14-6-11(12)15-7-13(16)10(9)3-1/h4-6,9-10,13,15H,1-3,7-8H2 |
| InChIKey | ATOBJMVNTVNKPZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |