C13H23NO2 — CID 102895063
3-methylbutan-2-yl 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate (PubChem CID 102895063) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-methylbutan-2-yl 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | 3-methylbutan-2-yl 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102895063 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 3-methylbutan-2-yl 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate |
| SMILES | CC(C)C(C)OC(=O)C1NCC2CCCC21 |
| InChI | InChI=1S/C13H23NO2/c1-8(2)9(3)16-13(15)12-11-6-4-5-10(11)7-14-12/h8-12,14H,4-7H2,1-3H3 |
| InChIKey | ROUQECVBXIPUAD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |