C17H21NO2S — CID 102895321
2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 102895321) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 102895321 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)C1C2CCCC2CN1CC1CSc2ccccc21 |
| InChI | InChI=1S/C17H21NO2S/c19-17(20)16-14-6-3-4-11(14)8-18(16)9-12-10-21-15-7-2-1-5-13(12)15/h1-2,5,7,11-12,14,16H,3-4,6,8-10H2,(H,19,20) |
| InChIKey | ZGKGISTVYBVUIY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |