C11H19NO4 — CID 102895475
2-(2,3-dihydroxypropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 102895475) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-(2,3-dihydroxypropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 102895475 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)C1C2CCCC2CN1CC(O)CO |
| InChI | InChI=1S/C11H19NO4/c13-6-8(14)5-12-4-7-2-1-3-9(7)10(12)11(15)16/h7-10,13-14H,1-6H2,(H,15,16) |
| InChIKey | NTXIAMLWQVZPHH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |