C17H22O4 — CID 102896207
3-(1-oxaspiro[4.5]decan-2-ylmethoxy)benzoic acid (PubChem CID 102896207) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-(1-oxaspiro[4.5]decan-2-ylmethoxy)benzoic acid.
| Compound Name | 3-(1-oxaspiro[4.5]decan-2-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 102896207 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-(1-oxaspiro[4.5]decan-2-ylmethoxy)benzoic acid |
| SMILES | O=C(O)c1cccc(OCC2CCC3(CCCCC3)O2)c1 |
| InChI | InChI=1S/C17H22O4/c18-16(19)13-5-4-6-14(11-13)20-12-15-7-10-17(21-15)8-2-1-3-9-17/h4-6,11,15H,1-3,7-10,12H2,(H,18,19) |
| InChIKey | QZZIROSKBHVGHV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |