C25H27F3N6O3S — CID 10289641
6-[[[(2S,4S)-1-[(2R)-2-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-2-(trifluoromethyl)piperidin-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one (PubChem CID 10289641) has the molecular formula C25H27F3N6O3S and a molecular weight of 548.59 g/mol. Its IUPAC name is 6-[[[(2S,4S)-1-[(2R)-2-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-2-(trifluoromethyl)piperidin-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one.
| Compound Name | 6-[[[(2S,4S)-1-[(2R)-2-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-2-(trifluoromethyl)piperidin-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 10289641 |
| Molecular Formula | C25H27F3N6O3S |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 6-[[[(2S,4S)-1-[(2R)-2-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]-2-(trifluoromethyl)piperidin-4-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
| SMILES | COc1ccc2nccc([C@@H](O)CN3CC[C@H](NCc4ccc5c(n4)NC(=O)CS5)C[C@H]3C(F)(F)F)c2n1 |
| InChI | InChI=1S/C25H27F3N6O3S/c1-37-22-5-3-17-23(33-22)16(6-8-29-17)18(35)12-34-9-7-14(10-20(34)25(26,27)28)30-11-15-2-4-19-24(31-15)32-21(36)13-38-19/h2-6,8,14,18,20,30,35H,7,9-13H2,1H3,(H,31,32,36)/t14-,18-,20-/m0/s1 |
| InChIKey | JXKSCJCNCVPHNT-DCPHZVHLSA-N |
| XLogP | 3.30 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |