About N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine
N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine (PubChem CID 102896428) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine |
| PubChem CID | 102896428 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine |
| SMILES | NCCCN(CC1CCC2(CCCC2)O1)C1CC1 |
| InChI | InChI=1S/C15H28N2O/c16-10-3-11-17(13-4-5-13)12-14-6-9-15(18-14)7-1-2-8-15/h13-14H,1-12,16H2 |
| InChIKey | DPXYOCKZKHTDEX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine?
The IUPAC name of N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine (CID 102896428) is N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine?
The canonical SMILES for N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine is NCCCN(CC1CCC2(CCCC2)O1)C1CC1.
What is the InChIKey of N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine?
The InChIKey is DPXYOCKZKHTDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c16-10-3-11-17(13-4-5-13)12-14-6-9-15(18-14)7-1-2-8-15/h13-14H,1-12,16H2.
What are the key properties of N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine?
N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine has a molecular weight of 252.40 g/mol, XLogP of 2.29, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N'-(1-oxaspiro[4.4]nonan-2-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 102896428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).