About N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine
N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (PubChem CID 102897437) has the molecular formula C13H21NO3S
and a molecular weight of 271.38 g/mol. Its IUPAC name is N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine.
Molecular Properties
| Compound Name | N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| PubChem CID | 102897437 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| SMILES | O=S1(=O)C=CC(NCC2CCC3(CCCC3)O2)C1 |
| InChI | InChI=1S/C13H21NO3S/c15-18(16)8-4-11(10-18)14-9-12-3-7-13(17-12)5-1-2-6-13/h4,8,11-12,14H,1-3,5-7,9-10H2 |
| InChIKey | IZCMPLJTKOBDCZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine?
The IUPAC name of N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (CID 102897437) is N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine.
What is the SMILES notation for N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine?
The canonical SMILES for N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine is O=S1(=O)C=CC(NCC2CCC3(CCCC3)O2)C1.
What is the InChIKey of N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine?
The InChIKey is IZCMPLJTKOBDCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3S/c15-18(16)8-4-11(10-18)14-9-12-3-7-13(17-12)5-1-2-6-13/h4,8,11-12,14H,1-3,5-7,9-10H2.
What are the key properties of N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine?
N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine has a molecular weight of 271.38 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-oxaspiro[4.4]nonan-2-ylmethyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine is sourced from PubChem (CID 102897437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).