C17H24N2O2 — CID 102898342
2-(1-oxaspiro[4.5]decan-2-ylmethoxy)benzenecarboximidamide (PubChem CID 102898342) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(1-oxaspiro[4.5]decan-2-ylmethoxy)benzenecarboximidamide.
| Compound Name | 2-(1-oxaspiro[4.5]decan-2-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 102898342 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-(1-oxaspiro[4.5]decan-2-ylmethoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1OCC1CCC2(CCCCC2)O1 |
| InChI | InChI=1S/C17H24N2O2/c18-16(19)14-6-2-3-7-15(14)20-12-13-8-11-17(21-13)9-4-1-5-10-17/h2-3,6-7,13H,1,4-5,8-12H2,(H3,18,19) |
| InChIKey | ZBMMEJCULMGUNK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|