C30H31N5O7 — CID 10289842
tert-butyl 4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-6,8,10-trioxo-2,7,9-triazaspiro[4.5]decane-2-carboxylate (PubChem CID 10289842) has the molecular formula C30H31N5O7 and a molecular weight of 573.61 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-6,8,10-trioxo-2,7,9-triazaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl 4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-6,8,10-trioxo-2,7,9-triazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 10289842 |
| Molecular Formula | C30H31N5O7 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | tert-butyl 4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]-6,8,10-trioxo-2,7,9-triazaspiro[4.5]decane-2-carboxylate |
| SMILES | Cc1cc(COc2ccc(C(=O)NC3CN(C(=O)OC(C)(C)C)CC34C(=O)NC(=O)NC4=O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C30H31N5O7/c1-17-13-19(21-7-5-6-8-22(21)31-17)15-41-20-11-9-18(10-12-20)24(36)32-23-14-35(28(40)42-29(2,3)4)16-30(23)25(37)33-27(39)34-26(30)38/h5-13,23H,14-16H2,1-4H3,(H,32,36)(H2,33,34,37,38,39) |
| InChIKey | BIMPKRWFMWVAKJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 156.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|