C15H20BFO4 — CID 102898830
[5-fluoro-2-(1-oxaspiro[4.4]nonan-2-ylmethoxy)phenyl]boronic acid (PubChem CID 102898830) has the molecular formula C15H20BFO4 and a molecular weight of 294.13 g/mol. Its IUPAC name is [5-fluoro-2-(1-oxaspiro[4.4]nonan-2-ylmethoxy)phenyl]boronic acid.
| Compound Name | [5-fluoro-2-(1-oxaspiro[4.4]nonan-2-ylmethoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 102898830 |
| Molecular Formula | C15H20BFO4 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [5-fluoro-2-(1-oxaspiro[4.4]nonan-2-ylmethoxy)phenyl]boronic acid |
| SMILES | OB(O)c1cc(F)ccc1OCC1CCC2(CCCC2)O1 |
| InChI | InChI=1S/C15H20BFO4/c17-11-3-4-14(13(9-11)16(18)19)20-10-12-5-8-15(21-12)6-1-2-7-15/h3-4,9,12,18-19H,1-2,5-8,10H2 |
| InChIKey | ZJWBGMPBJWBHCZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|