C33H45N5O5 — CID 10289950
N-[4,6-dimethoxy-2-(3-piperidin-1-ylpropylamino)pyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide (PubChem CID 10289950) has the molecular formula C33H45N5O5 and a molecular weight of 591.75 g/mol. Its IUPAC name is N-[4,6-dimethoxy-2-(3-piperidin-1-ylpropylamino)pyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[4,6-dimethoxy-2-(3-piperidin-1-ylpropylamino)pyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 10289950 |
| Molecular Formula | C33H45N5O5 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.34 |
| IUPAC Name | N-[4,6-dimethoxy-2-(3-piperidin-1-ylpropylamino)pyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
| SMILES | COc1nc(NCCCN2CCCCC2)nc(OC)c1NC(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)OC3(C)C)o1 |
| InChI | InChI=1S/C33H45N5O5/c1-21-18-24-25(33(4,5)43-32(24,2)3)20-22(21)19-23-12-13-26(42-23)28(39)35-27-29(40-6)36-31(37-30(27)41-7)34-14-11-17-38-15-9-8-10-16-38/h12-13,18,20H,8-11,14-17,19H2,1-7H3,(H,35,39)(H,34,36,37) |
| InChIKey | FPBNJCPEYAZOTG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|