C19H27BrO — CID 102899979
2-(3-bromo-2-methyl-3-phenylpropyl)-1-oxaspiro[4.5]decane (PubChem CID 102899979) has the molecular formula C19H27BrO and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-(3-bromo-2-methyl-3-phenylpropyl)-1-oxaspiro[4.5]decane.
| Compound Name | 2-(3-bromo-2-methyl-3-phenylpropyl)-1-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 102899979 |
| Molecular Formula | C19H27BrO |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-(3-bromo-2-methyl-3-phenylpropyl)-1-oxaspiro[4.5]decane |
| SMILES | CC(CC1CCC2(CCCCC2)O1)C(Br)c1ccccc1 |
| InChI | InChI=1S/C19H27BrO/c1-15(18(20)16-8-4-2-5-9-16)14-17-10-13-19(21-17)11-6-3-7-12-19/h2,4-5,8-9,15,17-18H,3,6-7,10-14H2,1H3 |
| InChIKey | CNCCHBUCUPNMBN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|