C36H61NO3S2 — CID 10290089
[(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] N-[3-[(3R)-dithiolan-3-yl]propyl]carbamate (PubChem CID 10290089) has the molecular formula C36H61NO3S2 and a molecular weight of 620.02 g/mol. Its IUPAC name is [(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] N-[3-[(3R)-dithiolan-3-yl]propyl]carbamate.
| Compound Name | [(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] N-[3-[(3R)-dithiolan-3-yl]propyl]carbamate |
|---|---|
| PubChem CID | 10290089 |
| Molecular Formula | C36H61NO3S2 |
| Molecular Weight | 620.02 g/mol |
| Exact Mass | 619.41 |
| IUPAC Name | [(2R)-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] N-[3-[(3R)-dithiolan-3-yl]propyl]carbamate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)NCCC[C@@H]1CCSS1)CC[C@@](C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C36H61NO3S2/c1-25(2)13-9-14-26(3)15-10-16-27(4)17-11-21-36(8)22-19-32-30(7)33(28(5)29(6)34(32)40-36)39-35(38)37-23-12-18-31-20-24-41-42-31/h25-27,31H,9-24H2,1-8H3,(H,37,38)/t26?,27?,31-,36-/m1/s1 |
| InChIKey | YCBISNQGSVVTBY-ACSIXMMRSA-N |
| XLogP | 11.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.02 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|