C15H25ClO — CID 102902372
2-[2-(chloromethyl)-2-methylbut-3-enyl]-1-oxaspiro[4.5]decane (PubChem CID 102902372) has the molecular formula C15H25ClO and a molecular weight of 256.82 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-2-methylbut-3-enyl]-1-oxaspiro[4.5]decane.
| Compound Name | 2-[2-(chloromethyl)-2-methylbut-3-enyl]-1-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 102902372 |
| Molecular Formula | C15H25ClO |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-[2-(chloromethyl)-2-methylbut-3-enyl]-1-oxaspiro[4.5]decane |
| SMILES | C=CC(C)(CCl)CC1CCC2(CCCCC2)O1 |
| InChI | InChI=1S/C15H25ClO/c1-3-14(2,12-16)11-13-7-10-15(17-13)8-5-4-6-9-15/h3,13H,1,4-12H2,2H3 |
| InChIKey | GPRIUGVEVDAZHV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|