C13H13N5O2 — CID 102902822
6-[2-(2-aminophenyl)ethoxy]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 102902822) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 6-[2-(2-aminophenyl)ethoxy]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-[2-(2-aminophenyl)ethoxy]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 102902822 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 6-[2-(2-aminophenyl)ethoxy]-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | Nc1ccccc1CCOc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C13H13N5O2/c14-10-4-2-1-3-9(10)7-8-20-12-6-5-11-15-16-13(19)18(11)17-12/h1-6H,7-8,14H2,(H,16,19) |
| InChIKey | RNHXCQSLOBLYAX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|