C14H18N4O — CID 102903466
6-N-[2-(2-methoxyethyl)phenyl]pyridine-2,3,6-triamine (PubChem CID 102903466) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 6-N-[2-(2-methoxyethyl)phenyl]pyridine-2,3,6-triamine.
| Compound Name | 6-N-[2-(2-methoxyethyl)phenyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 102903466 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 6-N-[2-(2-methoxyethyl)phenyl]pyridine-2,3,6-triamine |
| SMILES | COCCc1ccccc1Nc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C14H18N4O/c1-19-9-8-10-4-2-3-5-12(10)17-13-7-6-11(15)14(16)18-13/h2-7H,8-9,15H2,1H3,(H3,16,17,18) |
| InChIKey | AHQLCMMYLPPCBD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |