C17H27N3 — CID 102905509
3-methyl-N-[(1-methylindazol-3-yl)methyl]-2-propan-2-ylbutan-1-amine (PubChem CID 102905509) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 3-methyl-N-[(1-methylindazol-3-yl)methyl]-2-propan-2-ylbutan-1-amine.
| Compound Name | 3-methyl-N-[(1-methylindazol-3-yl)methyl]-2-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 102905509 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 3-methyl-N-[(1-methylindazol-3-yl)methyl]-2-propan-2-ylbutan-1-amine |
| SMILES | CC(C)C(CNCc1nn(C)c2ccccc12)C(C)C |
| InChI | InChI=1S/C17H27N3/c1-12(2)15(13(3)4)10-18-11-16-14-8-6-7-9-17(14)20(5)19-16/h6-9,12-13,15,18H,10-11H2,1-5H3 |
| InChIKey | AAHJZSLCVVTDLP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |