C42H30O18S6 — CID 10290604
4-[2,3,4,5,6-pentakis(4-sulfophenyl)phenyl]benzenesulfonic acid (PubChem CID 10290604) has the molecular formula C42H30O18S6 and a molecular weight of 1015.09 g/mol. Its IUPAC name is 4-[2,3,4,5,6-pentakis(4-sulfophenyl)phenyl]benzenesulfonic acid.
| Compound Name | 4-[2,3,4,5,6-pentakis(4-sulfophenyl)phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 10290604 |
| Molecular Formula | C42H30O18S6 |
| Molecular Weight | 1015.09 g/mol |
| Exact Mass | 1013.98 |
| IUPAC Name | 4-[2,3,4,5,6-pentakis(4-sulfophenyl)phenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2c(-c3ccc(S(=O)(=O)O)cc3)c(-c3ccc(S(=O)(=O)O)cc3)c(-c3ccc(S(=O)(=O)O)cc3)c(-c3ccc(S(=O)(=O)O)cc3)c2-c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C42H30O18S6/c43-61(44,45)31-13-1-25(2-14-31)37-38(26-3-15-32(16-4-26)62(46,47)48)40(28-7-19-34(20-8-28)64(52,53)54)42(30-11-23-36(24-12-30)66(58,59)60)41(29-9-21-35(22-10-29)65(55,56)57)39(37)27-5-17-33(18-6-27)63(49,50)51/h1-24H,(H,43,44,45)(H,46,47,48)(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,58,59,60) |
| InChIKey | SIJMWTBYLYPRGQ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 326.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.09 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|