About 3-(isothiocyanatomethyl)-2,4-dimethylpentane
3-(isothiocyanatomethyl)-2,4-dimethylpentane (PubChem CID 102906502) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is 3-(isothiocyanatomethyl)-2,4-dimethylpentane.
Molecular Properties
| Compound Name | 3-(isothiocyanatomethyl)-2,4-dimethylpentane |
| PubChem CID | 102906502 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 3-(isothiocyanatomethyl)-2,4-dimethylpentane |
| SMILES | CC(C)C(CN=C=S)C(C)C |
| InChI | InChI=1S/C9H17NS/c1-7(2)9(8(3)4)5-10-6-11/h7-9H,5H2,1-4H3 |
| InChIKey | AJASBFXCGXYINQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(isothiocyanatomethyl)-2,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(isothiocyanatomethyl)-2,4-dimethylpentane?
The IUPAC name of 3-(isothiocyanatomethyl)-2,4-dimethylpentane (CID 102906502) is 3-(isothiocyanatomethyl)-2,4-dimethylpentane.
What is the SMILES notation for 3-(isothiocyanatomethyl)-2,4-dimethylpentane?
The canonical SMILES for 3-(isothiocyanatomethyl)-2,4-dimethylpentane is CC(C)C(CN=C=S)C(C)C.
What is the InChIKey of 3-(isothiocyanatomethyl)-2,4-dimethylpentane?
The InChIKey is AJASBFXCGXYINQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS/c1-7(2)9(8(3)4)5-10-6-11/h7-9H,5H2,1-4H3.
What are the key properties of 3-(isothiocyanatomethyl)-2,4-dimethylpentane?
3-(isothiocyanatomethyl)-2,4-dimethylpentane has a molecular weight of 171.31 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(isothiocyanatomethyl)-2,4-dimethylpentane is sourced from PubChem (CID 102906502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).