C18H27ClN2 — CID 102906987
2-(2-chloroethyl)-6-methyl-1-(3-methyl-2-propan-2-ylbutyl)benzimidazole (PubChem CID 102906987) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 2-(2-chloroethyl)-6-methyl-1-(3-methyl-2-propan-2-ylbutyl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-6-methyl-1-(3-methyl-2-propan-2-ylbutyl)benzimidazole |
|---|---|
| PubChem CID | 102906987 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-(2-chloroethyl)-6-methyl-1-(3-methyl-2-propan-2-ylbutyl)benzimidazole |
| SMILES | Cc1ccc2nc(CCCl)n(CC(C(C)C)C(C)C)c2c1 |
| InChI | InChI=1S/C18H27ClN2/c1-12(2)15(13(3)4)11-21-17-10-14(5)6-7-16(17)20-18(21)8-9-19/h6-7,10,12-13,15H,8-9,11H2,1-5H3 |
| InChIKey | KBKWTTVWPZSHMS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|