(3R)-3-hydroxypentanoic acid

C5H10O3 — CID 10290775

IUPAC(3R)-3-hydroxypentanoic acid
SMILESCC[C@@H](O)CC(=O)O
InChIInChI=1S/C5H10O3/c1-2-4(6)3-5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m1/s1
InChIKeyREKYPYSUBKSCAT-SCSAIBSYSA-N
MW118.13 g/mol
LogP0.23
Rot. Bonds3

About (3R)-3-hydroxypentanoic acid

(3R)-3-hydroxypentanoic acid (PubChem CID 10290775) has the molecular formula C5H10O3 and a molecular weight of 118.13 g/mol. Its IUPAC name is (3R)-3-hydroxypentanoic acid.

Molecular Properties

Compound Name(3R)-3-hydroxypentanoic acid
PubChem CID10290775
Molecular FormulaC5H10O3
Molecular Weight118.13 g/mol
Exact Mass118.06
IUPAC Name(3R)-3-hydroxypentanoic acid
SMILESCC[C@@H](O)CC(=O)O
InChIInChI=1S/C5H10O3/c1-2-4(6)3-5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m1/s1
InChIKeyREKYPYSUBKSCAT-SCSAIBSYSA-N
XLogP0.23
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500118.13
LogP ≤ 50.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (3R)-3-hydroxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-3-hydroxypentanoic acid?
The IUPAC name of (3R)-3-hydroxypentanoic acid (CID 10290775) is (3R)-3-hydroxypentanoic acid.
What is the SMILES notation for (3R)-3-hydroxypentanoic acid?
The canonical SMILES for (3R)-3-hydroxypentanoic acid is CC[C@@H](O)CC(=O)O.
What is the InChIKey of (3R)-3-hydroxypentanoic acid?
The InChIKey is REKYPYSUBKSCAT-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H10O3/c1-2-4(6)3-5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m1/s1.
What are the key properties of (3R)-3-hydroxypentanoic acid?
(3R)-3-hydroxypentanoic acid has a molecular weight of 118.13 g/mol, XLogP of 0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxypentanoic acid is sourced from PubChem (CID 10290775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).