About (1R)-1-cyclohexylethanol
(1R)-1-cyclohexylethanol (PubChem CID 10290808) has the molecular formula C8H16O
and a molecular weight of 128.21 g/mol. Its IUPAC name is (1R)-1-cyclohexylethanol.
Molecular Properties
| Compound Name | (1R)-1-cyclohexylethanol |
| PubChem CID | 10290808 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (1R)-1-cyclohexylethanol |
| SMILES | C[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C8H16O/c1-7(9)8-5-3-2-4-6-8/h7-9H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | JMSUNAQVHOHLMX-SSDOTTSWSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-cyclohexylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-cyclohexylethanol?
The IUPAC name of (1R)-1-cyclohexylethanol (CID 10290808) is (1R)-1-cyclohexylethanol.
What is the SMILES notation for (1R)-1-cyclohexylethanol?
The canonical SMILES for (1R)-1-cyclohexylethanol is C[C@@H](O)C1CCCCC1.
What is the InChIKey of (1R)-1-cyclohexylethanol?
The InChIKey is JMSUNAQVHOHLMX-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H16O/c1-7(9)8-5-3-2-4-6-8/h7-9H,2-6H2,1H3/t7-/m1/s1.
What are the key properties of (1R)-1-cyclohexylethanol?
(1R)-1-cyclohexylethanol has a molecular weight of 128.21 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-cyclohexylethanol is sourced from PubChem (CID 10290808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).