About 2-(4,5-diaminopyrazol-1-yl)ethanol
2-(4,5-diaminopyrazol-1-yl)ethanol (PubChem CID 10290847) has the molecular formula C5H10N4O
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-(4,5-diaminopyrazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4,5-diaminopyrazol-1-yl)ethanol |
| PubChem CID | 10290847 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 2-(4,5-diaminopyrazol-1-yl)ethanol |
| SMILES | Nc1cnn(CCO)c1N |
| InChI | InChI=1S/C5H10N4O/c6-4-3-8-9(1-2-10)5(4)7/h3,10H,1-2,6-7H2 |
| InChIKey | KDBUTNSQYYLYOY-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4,5-diaminopyrazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-diaminopyrazol-1-yl)ethanol?
The IUPAC name of 2-(4,5-diaminopyrazol-1-yl)ethanol (CID 10290847) is 2-(4,5-diaminopyrazol-1-yl)ethanol.
What is the SMILES notation for 2-(4,5-diaminopyrazol-1-yl)ethanol?
The canonical SMILES for 2-(4,5-diaminopyrazol-1-yl)ethanol is Nc1cnn(CCO)c1N.
What is the InChIKey of 2-(4,5-diaminopyrazol-1-yl)ethanol?
The InChIKey is KDBUTNSQYYLYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O/c6-4-3-8-9(1-2-10)5(4)7/h3,10H,1-2,6-7H2.
What are the key properties of 2-(4,5-diaminopyrazol-1-yl)ethanol?
2-(4,5-diaminopyrazol-1-yl)ethanol has a molecular weight of 142.16 g/mol, XLogP of -0.96, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-diaminopyrazol-1-yl)ethanol is sourced from PubChem (CID 10290847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).