C15H20N2O3 — CID 102908577
1-[2-(2-methoxyethyl)phenyl]-3,3-dimethylpiperazine-2,5-dione (PubChem CID 102908577) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-[2-(2-methoxyethyl)phenyl]-3,3-dimethylpiperazine-2,5-dione.
| Compound Name | 1-[2-(2-methoxyethyl)phenyl]-3,3-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 102908577 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-[2-(2-methoxyethyl)phenyl]-3,3-dimethylpiperazine-2,5-dione |
| SMILES | COCCc1ccccc1N1CC(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C15H20N2O3/c1-15(2)14(19)17(10-13(18)16-15)12-7-5-4-6-11(12)8-9-20-3/h4-7H,8-10H2,1-3H3,(H,16,18) |
| InChIKey | LFZWYMPKQSXSMV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |