About 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one
7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 10290924) has the molecular formula C20H22N2O3
and a molecular weight of 338.41 g/mol. Its IUPAC name is 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 10290924 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CCOc1cc2c(cc1OCC)N(C)C(=O)CN=C2c1ccccc1 |
| InChI | InChI=1S/C20H22N2O3/c1-4-24-17-11-15-16(12-18(17)25-5-2)22(3)19(23)13-21-20(15)14-9-7-6-8-10-14/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | NALNPEFGPDBRCS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (CID 10290924) is 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one is CCOc1cc2c(cc1OCC)N(C)C(=O)CN=C2c1ccccc1.
What is the InChIKey of 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The InChIKey is NALNPEFGPDBRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O3/c1-4-24-17-11-15-16(12-18(17)25-5-2)22(3)19(23)13-21-20(15)14-9-7-6-8-10-14/h6-12H,4-5,13H2,1-3H3.
What are the key properties of 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one has a molecular weight of 338.41 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-diethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 10290924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).