About 1,2:3,4-Di-O-cyclohexylidene-myo-inositol
1,2:3,4-Di-O-cyclohexylidene-myo-inositol (PubChem CID 10291014) has the molecular formula C18H28O6
and a molecular weight of 340.42 g/mol.
Molecular Properties
| Compound Name | 1,2:3,4-Di-O-cyclohexylidene-myo-inositol |
| PubChem CID | 10291014 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | — |
| SMILES | O[C@H]1[C@H](O)[C@H]2OC3(CCCCC3)O[C@H]2[C@H]2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C18H28O6/c19-11-12(20)14-16(24-18(22-14)9-5-2-6-10-18)15-13(11)21-17(23-15)7-3-1-4-8-17/h11-16,19-20H,1-10H2/t11-,12-,13+,14+,15-,16+/m0/s1 |
| InChIKey | PHAPESVEHHOBEI-UGYDUONOSA-N |
| XLogP | 1.61 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,2:3,4-Di-O-cyclohexylidene-myo-inositol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2:3,4-Di-O-cyclohexylidene-myo-inositol?
The IUPAC name of 1,2:3,4-Di-O-cyclohexylidene-myo-inositol (CID 10291014) is not available.
What is the SMILES notation for 1,2:3,4-Di-O-cyclohexylidene-myo-inositol?
The canonical SMILES for 1,2:3,4-Di-O-cyclohexylidene-myo-inositol is O[C@H]1[C@H](O)[C@H]2OC3(CCCCC3)O[C@H]2[C@H]2OC3(CCCCC3)O[C@H]12.
What is the InChIKey of 1,2:3,4-Di-O-cyclohexylidene-myo-inositol?
The InChIKey is PHAPESVEHHOBEI-UGYDUONOSA-N. The full InChI is InChI=1S/C18H28O6/c19-11-12(20)14-16(24-18(22-14)9-5-2-6-10-18)15-13(11)21-17(23-15)7-3-1-4-8-17/h11-16,19-20H,1-10H2/t11-,12-,13+,14+,15-,16+/m0/s1.
What are the key properties of 1,2:3,4-Di-O-cyclohexylidene-myo-inositol?
1,2:3,4-Di-O-cyclohexylidene-myo-inositol has a molecular weight of 340.42 g/mol, XLogP of 1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2:3,4-Di-O-cyclohexylidene-myo-inositol is sourced from PubChem (CID 10291014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).