C12H10F3NO — CID 102911175
1-(3,3,3-trifluoropropyl)indole-6-carbaldehyde (PubChem CID 102911175) has the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropyl)indole-6-carbaldehyde.
| Compound Name | 1-(3,3,3-trifluoropropyl)indole-6-carbaldehyde |
|---|---|
| PubChem CID | 102911175 |
| Molecular Formula | C12H10F3NO |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-(3,3,3-trifluoropropyl)indole-6-carbaldehyde |
| SMILES | O=Cc1ccc2ccn(CCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C12H10F3NO/c13-12(14,15)4-6-16-5-3-10-2-1-9(8-17)7-11(10)16/h1-3,5,7-8H,4,6H2 |
| InChIKey | MZLZQWLNEWOVHJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|