About 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine
1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine (PubChem CID 102912648) has the molecular formula C17H36N2
and a molecular weight of 268.49 g/mol. Its IUPAC name is 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine |
| PubChem CID | 102912648 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine |
| SMILES | CC(C)C(CNC1(CN)CCC(C)C(C)C1)C(C)C |
| InChI | InChI=1S/C17H36N2/c1-12(2)16(13(3)4)10-19-17(11-18)8-7-14(5)15(6)9-17/h12-16,19H,7-11,18H2,1-6H3 |
| InChIKey | RGCSMQJAOFRSTH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine?
The IUPAC name of 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine (CID 102912648) is 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine.
What is the SMILES notation for 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine?
The canonical SMILES for 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine is CC(C)C(CNC1(CN)CCC(C)C(C)C1)C(C)C.
What is the InChIKey of 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine?
The InChIKey is RGCSMQJAOFRSTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36N2/c1-12(2)16(13(3)4)10-19-17(11-18)8-7-14(5)15(6)9-17/h12-16,19H,7-11,18H2,1-6H3.
What are the key properties of 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine?
1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine has a molecular weight of 268.49 g/mol, XLogP of 3.66, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)-3,4-dimethyl-N-(3-methyl-2-propan-2-ylbutyl)cyclohexan-1-amine is sourced from PubChem (CID 102912648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).