C14H16N4O — CID 102912872
[1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]indol-5-yl]methanol (PubChem CID 102912872) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]indol-5-yl]methanol.
| Compound Name | [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]indol-5-yl]methanol |
|---|---|
| PubChem CID | 102912872 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]indol-5-yl]methanol |
| SMILES | CCn1ncnc1Cn1ccc2cc(CO)ccc21 |
| InChI | InChI=1S/C14H16N4O/c1-2-18-14(15-10-16-18)8-17-6-5-12-7-11(9-19)3-4-13(12)17/h3-7,10,19H,2,8-9H2,1H3 |
| InChIKey | LOLQFLRWXXLVJC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |