About 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol
3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol (PubChem CID 10291366) has the molecular formula C23H25NO2
and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol |
| PubChem CID | 10291366 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol |
| SMILES | CO[C@]1(C#CC(O)(c2ccccc2)c2ccccc2)CN2CCC1CC2 |
| InChI | InChI=1S/C23H25NO2/c1-26-22(18-24-16-12-19(22)13-17-24)14-15-23(25,20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-11,19,25H,12-13,16-18H2,1H3/t22-/m1/s1 |
| InChIKey | WUMIJQZPHGJALC-JOCHJYFZSA-N |
| XLogP | 3.04 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol?
The IUPAC name of 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol (CID 10291366) is 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol.
What is the SMILES notation for 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol?
The canonical SMILES for 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol is CO[C@]1(C#CC(O)(c2ccccc2)c2ccccc2)CN2CCC1CC2.
What is the InChIKey of 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol?
The InChIKey is WUMIJQZPHGJALC-JOCHJYFZSA-N. The full InChI is InChI=1S/C23H25NO2/c1-26-22(18-24-16-12-19(22)13-17-24)14-15-23(25,20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-11,19,25H,12-13,16-18H2,1H3/t22-/m1/s1.
What are the key properties of 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol?
3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol has a molecular weight of 347.46 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R)-3-methoxy-1-azabicyclo[2.2.2]octan-3-yl]-1,1-diphenylprop-2-yn-1-ol is sourced from PubChem (CID 10291366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).