C16H24N2O — CID 102914086
5-[7-(ethylaminomethyl)indol-1-yl]pentan-1-ol (PubChem CID 102914086) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-[7-(ethylaminomethyl)indol-1-yl]pentan-1-ol.
| Compound Name | 5-[7-(ethylaminomethyl)indol-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 102914086 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-[7-(ethylaminomethyl)indol-1-yl]pentan-1-ol |
| SMILES | CCNCc1cccc2ccn(CCCCCO)c12 |
| InChI | InChI=1S/C16H24N2O/c1-2-17-13-15-8-6-7-14-9-11-18(16(14)15)10-4-3-5-12-19/h6-9,11,17,19H,2-5,10,12-13H2,1H3 |
| InChIKey | GSNCQXKZEZNGNQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|